C29H42N4O — CID 142228945
4-[(4-methylcyclohexyl)methylamino]-1-phenylbutan-1-ol;N,N,2-trimethylquinazolin-4-amine (PubChem CID 142228945) has the molecular formula C29H42N4O and a molecular weight of 462.68 g/mol. Its IUPAC name is 4-[(4-methylcyclohexyl)methylamino]-1-phenylbutan-1-ol;N,N,2-trimethylquinazolin-4-amine.
| Compound Name | 4-[(4-methylcyclohexyl)methylamino]-1-phenylbutan-1-ol;N,N,2-trimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 142228945 |
| Molecular Formula | C29H42N4O |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.34 |
| IUPAC Name | 4-[(4-methylcyclohexyl)methylamino]-1-phenylbutan-1-ol;N,N,2-trimethylquinazolin-4-amine |
| SMILES | CC1CCC(CNCCCC(O)c2ccccc2)CC1.Cc1nc(N(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C18H29NO.C11H13N3/c1-15-9-11-16(12-10-15)14-19-13-5-8-18(20)17-6-3-2-4-7-17;1-8-12-10-7-5-4-6-9(10)11(13-8)14(2)3/h2-4,6-7,15-16,18-20H,5,8-14H2,1H3;4-7H,1-3H3 |
| InChIKey | OSWSNWKLVIQKKL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|