C27H35Cl3N4 — CID 142228957
N-[(4-methylcyclohexyl)methyl]-2-(2,3,6-trichlorophenyl)ethanamine;N,N,2-trimethylquinazolin-4-amine (PubChem CID 142228957) has the molecular formula C27H35Cl3N4 and a molecular weight of 521.96 g/mol. Its IUPAC name is N-[(4-methylcyclohexyl)methyl]-2-(2,3,6-trichlorophenyl)ethanamine;N,N,2-trimethylquinazolin-4-amine.
| Compound Name | N-[(4-methylcyclohexyl)methyl]-2-(2,3,6-trichlorophenyl)ethanamine;N,N,2-trimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 142228957 |
| Molecular Formula | C27H35Cl3N4 |
| Molecular Weight | 521.96 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | N-[(4-methylcyclohexyl)methyl]-2-(2,3,6-trichlorophenyl)ethanamine;N,N,2-trimethylquinazolin-4-amine |
| SMILES | CC1CCC(CNCCc2c(Cl)ccc(Cl)c2Cl)CC1.Cc1nc(N(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C16H22Cl3N.C11H13N3/c1-11-2-4-12(5-3-11)10-20-9-8-13-14(17)6-7-15(18)16(13)19;1-8-12-10-7-5-4-6-9(10)11(13-8)14(2)3/h6-7,11-12,20H,2-5,8-10H2,1H3;4-7H,1-3H3 |
| InChIKey | AYAJCDYLLCLUOG-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.96 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|