C31H45FN4O — CID 142229180
ethene;1-(4-fluorophenyl)-4-[(4-methylcyclohexyl)methylamino]butan-1-ol;N,N,2-trimethylquinazolin-4-amine (PubChem CID 142229180) has the molecular formula C31H45FN4O and a molecular weight of 508.73 g/mol. Its IUPAC name is ethene;1-(4-fluorophenyl)-4-[(4-methylcyclohexyl)methylamino]butan-1-ol;N,N,2-trimethylquinazolin-4-amine.
| Compound Name | ethene;1-(4-fluorophenyl)-4-[(4-methylcyclohexyl)methylamino]butan-1-ol;N,N,2-trimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 142229180 |
| Molecular Formula | C31H45FN4O |
| Molecular Weight | 508.73 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | ethene;1-(4-fluorophenyl)-4-[(4-methylcyclohexyl)methylamino]butan-1-ol;N,N,2-trimethylquinazolin-4-amine |
| SMILES | C=C.CC1CCC(CNCCCC(O)c2ccc(F)cc2)CC1.Cc1nc(N(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C18H28FNO.C11H13N3.C2H4/c1-14-4-6-15(7-5-14)13-20-12-2-3-18(21)16-8-10-17(19)11-9-16;1-8-12-10-7-5-4-6-9(10)11(13-8)14(2)3;1-2/h8-11,14-15,18,20-21H,2-7,12-13H2,1H3;4-7H,1-3H3;1-2H2 |
| InChIKey | GDHDVDXEIPHAMG-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.73 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|