C28H40N4O — CID 142230775
2-[[(4-ethylcyclohexyl)methylamino]methyl]-6-methylphenol;N,N,2-trimethylquinazolin-4-amine (PubChem CID 142230775) has the molecular formula C28H40N4O and a molecular weight of 448.66 g/mol. Its IUPAC name is 2-[[(4-ethylcyclohexyl)methylamino]methyl]-6-methylphenol;N,N,2-trimethylquinazolin-4-amine.
| Compound Name | 2-[[(4-ethylcyclohexyl)methylamino]methyl]-6-methylphenol;N,N,2-trimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 142230775 |
| Molecular Formula | C28H40N4O |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 2-[[(4-ethylcyclohexyl)methylamino]methyl]-6-methylphenol;N,N,2-trimethylquinazolin-4-amine |
| SMILES | CCC1CCC(CNCc2cccc(C)c2O)CC1.Cc1nc(N(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C17H27NO.C11H13N3/c1-3-14-7-9-15(10-8-14)11-18-12-16-6-4-5-13(2)17(16)19;1-8-12-10-7-5-4-6-9(10)11(13-8)14(2)3/h4-6,14-15,18-19H,3,7-12H2,1-2H3;4-7H,1-3H3 |
| InChIKey | AFYTWPNLVIJUQL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|