C24H28N4O2 — CID 68886825
benzyl 4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexane-1-carboxylate (PubChem CID 68886825) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is benzyl 4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexane-1-carboxylate.
| Compound Name | benzyl 4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 68886825 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | benzyl 4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexane-1-carboxylate |
| SMILES | CN(C)c1nc(NC2CCC(C(=O)OCc3ccccc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H28N4O2/c1-28(2)22-20-10-6-7-11-21(20)26-24(27-22)25-19-14-12-18(13-15-19)23(29)30-16-17-8-4-3-5-9-17/h3-11,18-19H,12-16H2,1-2H3,(H,25,26,27) |
| InChIKey | GRJSJBBFNLZBCF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |