C30H43N5 — CID 142231011
2-N-[4-[6-[4-(dimethylamino)phenyl]hexyl]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine (PubChem CID 142231011) has the molecular formula C30H43N5 and a molecular weight of 473.71 g/mol. Its IUPAC name is 2-N-[4-[6-[4-(dimethylamino)phenyl]hexyl]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine.
| Compound Name | 2-N-[4-[6-[4-(dimethylamino)phenyl]hexyl]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 142231011 |
| Molecular Formula | C30H43N5 |
| Molecular Weight | 473.71 g/mol |
| Exact Mass | 473.35 |
| IUPAC Name | 2-N-[4-[6-[4-(dimethylamino)phenyl]hexyl]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine |
| SMILES | CN(C)c1ccc(CCCCCCC2CCC(Nc3nc(N(C)C)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C30H43N5/c1-34(2)26-21-17-24(18-22-26)12-8-6-5-7-11-23-15-19-25(20-16-23)31-30-32-28-14-10-9-13-27(28)29(33-30)35(3)4/h9-10,13-14,17-18,21-23,25H,5-8,11-12,15-16,19-20H2,1-4H3,(H,31,32,33) |
| InChIKey | BPAKQBRQPIWMGU-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.71 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|