C24H39N3 — CID 142229131
ethane;2-[4-(4-ethylcyclohexyl)butyl]-N,N-dimethylquinazolin-4-amine (PubChem CID 142229131) has the molecular formula C24H39N3 and a molecular weight of 369.60 g/mol. Its IUPAC name is ethane;2-[4-(4-ethylcyclohexyl)butyl]-N,N-dimethylquinazolin-4-amine.
| Compound Name | ethane;2-[4-(4-ethylcyclohexyl)butyl]-N,N-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 142229131 |
| Molecular Formula | C24H39N3 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 369.31 |
| IUPAC Name | ethane;2-[4-(4-ethylcyclohexyl)butyl]-N,N-dimethylquinazolin-4-amine |
| SMILES | CC.CCC1CCC(CCCCc2nc(N(C)C)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C22H33N3.C2H6/c1-4-17-13-15-18(16-14-17)9-5-8-12-21-23-20-11-7-6-10-19(20)22(24-21)25(2)3;1-2/h6-7,10-11,17-18H,4-5,8-9,12-16H2,1-3H3;1-2H3 |
| InChIKey | ZDABHYCABFHAIP-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|