C30H36F3N3O — CID 142229060
N,N-dimethyl-2-[(E)-3-[4-[4-[2-(trifluoromethoxy)phenyl]butyl]cyclohexyl]prop-2-enyl]quinazolin-4-amine (PubChem CID 142229060) has the molecular formula C30H36F3N3O and a molecular weight of 511.63 g/mol. Its IUPAC name is N,N-dimethyl-2-[(E)-3-[4-[4-[2-(trifluoromethoxy)phenyl]butyl]cyclohexyl]prop-2-enyl]quinazolin-4-amine.
| Compound Name | N,N-dimethyl-2-[(E)-3-[4-[4-[2-(trifluoromethoxy)phenyl]butyl]cyclohexyl]prop-2-enyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 142229060 |
| Molecular Formula | C30H36F3N3O |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | N,N-dimethyl-2-[(E)-3-[4-[4-[2-(trifluoromethoxy)phenyl]butyl]cyclohexyl]prop-2-enyl]quinazolin-4-amine |
| SMILES | CN(C)c1nc(C/C=C/C2CCC(CCCCc3ccccc3OC(F)(F)F)CC2)nc2ccccc12 |
| InChI | InChI=1S/C30H36F3N3O/c1-36(2)29-25-14-6-7-15-26(25)34-28(35-29)17-9-11-23-20-18-22(19-21-23)10-3-4-12-24-13-5-8-16-27(24)37-30(31,32)33/h5-9,11,13-16,22-23H,3-4,10,12,17-21H2,1-2H3/b11-9+ |
| InChIKey | DJLSIBQJTYHUNH-PKNBQFBNSA-N |
| XLogP | 7.91 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|