C31H41FN4 — CID 142230693
2-[3-[4-[4-(6-fluoro-3a,7a-dihydro-1H-indol-3-yl)butyl]cyclohexyl]propyl]-N,N-dimethylquinazolin-4-amine (PubChem CID 142230693) has the molecular formula C31H41FN4 and a molecular weight of 488.70 g/mol. Its IUPAC name is 2-[3-[4-[4-(6-fluoro-3a,7a-dihydro-1H-indol-3-yl)butyl]cyclohexyl]propyl]-N,N-dimethylquinazolin-4-amine.
| Compound Name | 2-[3-[4-[4-(6-fluoro-3a,7a-dihydro-1H-indol-3-yl)butyl]cyclohexyl]propyl]-N,N-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 142230693 |
| Molecular Formula | C31H41FN4 |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | 2-[3-[4-[4-(6-fluoro-3a,7a-dihydro-1H-indol-3-yl)butyl]cyclohexyl]propyl]-N,N-dimethylquinazolin-4-amine |
| SMILES | CN(C)c1nc(CCCC2CCC(CCCCC3=CNC4C=C(F)C=CC34)CC2)nc2ccccc12 |
| InChI | InChI=1S/C31H41FN4/c1-36(2)31-27-11-5-6-12-28(27)34-30(35-31)13-7-9-23-16-14-22(15-17-23)8-3-4-10-24-21-33-29-20-25(32)18-19-26(24)29/h5-6,11-12,18-23,26,29,33H,3-4,7-10,13-17H2,1-2H3 |
| InChIKey | XUHDHSSSXVKOAW-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|