C32H49FN4 — CID 142229145
(3Z,5E,8Z)-8-ethyl-5-fluoro-7-methyl-2,7-dihydro-1H-azonine;1-methyl-4-propylcyclohexane;N,N,2-trimethylquinazolin-4-amine (PubChem CID 142229145) has the molecular formula C32H49FN4 and a molecular weight of 508.77 g/mol. Its IUPAC name is (3Z,5E,8Z)-8-ethyl-5-fluoro-7-methyl-2,7-dihydro-1H-azonine;1-methyl-4-propylcyclohexane;N,N,2-trimethylquinazolin-4-amine.
| Compound Name | (3Z,5E,8Z)-8-ethyl-5-fluoro-7-methyl-2,7-dihydro-1H-azonine;1-methyl-4-propylcyclohexane;N,N,2-trimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 142229145 |
| Molecular Formula | C32H49FN4 |
| Molecular Weight | 508.77 g/mol |
| Exact Mass | 508.39 |
| IUPAC Name | (3Z,5E,8Z)-8-ethyl-5-fluoro-7-methyl-2,7-dihydro-1H-azonine;1-methyl-4-propylcyclohexane;N,N,2-trimethylquinazolin-4-amine |
| SMILES | CC/C1=C/NC/C=C\C(F)=C/C1C.CCCC1CCC(C)CC1.Cc1nc(N(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C11H16FN.C11H13N3.C10H20/c1-3-10-8-13-6-4-5-11(12)7-9(10)2;1-8-12-10-7-5-4-6-9(10)11(13-8)14(2)3;1-3-4-10-7-5-9(2)6-8-10/h4-5,7-9,13H,3,6H2,1-2H3;4-7H,1-3H3;9-10H,3-8H2,1-2H3/b5-4-,10-8-,11-7+;; |
| InChIKey | COJCJLNYCVYBAP-SETDYABKSA-N |
| XLogP | 8.55 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.77 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |