C29H50ClN5 — CID 142231303
N-[(Z)-1-chlorobutan-2-ylideneamino]-N-methylmethanamine;1,4-dipropylcyclohexane;N,N,2-trimethylquinazolin-4-amine (PubChem CID 142231303) has the molecular formula C29H50ClN5 and a molecular weight of 504.21 g/mol. Its IUPAC name is N-[(Z)-1-chlorobutan-2-ylideneamino]-N-methylmethanamine;1,4-dipropylcyclohexane;N,N,2-trimethylquinazolin-4-amine.
| Compound Name | N-[(Z)-1-chlorobutan-2-ylideneamino]-N-methylmethanamine;1,4-dipropylcyclohexane;N,N,2-trimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 142231303 |
| Molecular Formula | C29H50ClN5 |
| Molecular Weight | 504.21 g/mol |
| Exact Mass | 503.38 |
| IUPAC Name | N-[(Z)-1-chlorobutan-2-ylideneamino]-N-methylmethanamine;1,4-dipropylcyclohexane;N,N,2-trimethylquinazolin-4-amine |
| SMILES | CC/C(CCl)=N/N(C)C.CCCC1CCC(CCC)CC1.Cc1nc(N(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C12H24.C11H13N3.C6H13ClN2/c1-3-5-11-7-9-12(6-4-2)10-8-11;1-8-12-10-7-5-4-6-9(10)11(13-8)14(2)3;1-4-6(5-7)8-9(2)3/h11-12H,3-10H2,1-2H3;4-7H,1-3H3;4-5H2,1-3H3/b;;8-6- |
| InChIKey | YXNQLYJCIVWWEU-MNZOIHNJSA-N |
| XLogP | 7.95 |
| TPSA | 44.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.21 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|