C30H46N6O — CID 162072200
2-N-[4-[[4-[2-(diethylaminooxy)ethyl]phenyl]methylamino]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine;methane (PubChem CID 162072200) has the molecular formula C30H46N6O and a molecular weight of 506.74 g/mol. Its IUPAC name is 2-N-[4-[[4-[2-(diethylaminooxy)ethyl]phenyl]methylamino]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine;methane.
| Compound Name | 2-N-[4-[[4-[2-(diethylaminooxy)ethyl]phenyl]methylamino]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine;methane |
|---|---|
| PubChem CID | 162072200 |
| Molecular Formula | C30H46N6O |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 506.37 |
| IUPAC Name | 2-N-[4-[[4-[2-(diethylaminooxy)ethyl]phenyl]methylamino]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine;methane |
| SMILES | C.CCN(CC)OCCc1ccc(CNC2CCC(Nc3nc(N(C)C)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C29H42N6O.CH4/c1-5-35(6-2)36-20-19-22-11-13-23(14-12-22)21-30-24-15-17-25(18-16-24)31-29-32-27-10-8-7-9-26(27)28(33-29)34(3)4;/h7-14,24-25,30H,5-6,15-21H2,1-4H3,(H,31,32,33);1H4 |
| InChIKey | ZBFUWNWLJFAPBA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|