C13H16N4S — CID 97250083
2-N-[(3S)-thian-3-yl]quinazoline-2,4-diamine (PubChem CID 97250083) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is 2-N-[(3S)-thian-3-yl]quinazoline-2,4-diamine.
| Compound Name | 2-N-[(3S)-thian-3-yl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 97250083 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-N-[(3S)-thian-3-yl]quinazoline-2,4-diamine |
| SMILES | Nc1nc(N[C@H]2CCCSC2)nc2ccccc12 |
| InChI | InChI=1S/C13H16N4S/c14-12-10-5-1-2-6-11(10)16-13(17-12)15-9-4-3-7-18-8-9/h1-2,5-6,9H,3-4,7-8H2,(H3,14,15,16,17)/t9-/m0/s1 |
| InChIKey | PDMMNVWNQQTNRR-VIFPVBQESA-N |
| XLogP | 2.52 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |