C10H16N4O2S — CID 113249980
4,6-dimethoxy-N-(thian-3-yl)-1,3,5-triazin-2-amine (PubChem CID 113249980) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4,6-dimethoxy-N-(thian-3-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dimethoxy-N-(thian-3-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 113249980 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4,6-dimethoxy-N-(thian-3-yl)-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NC2CCCSC2)nc(OC)n1 |
| InChI | InChI=1S/C10H16N4O2S/c1-15-9-12-8(13-10(14-9)16-2)11-7-4-3-5-17-6-7/h7H,3-6H2,1-2H3,(H,11,12,13,14) |
| InChIKey | YCMJFNQEJRDYMV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |