C11H18N4O2 — CID 15184090
N-cyclohexyl-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 15184090) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is N-cyclohexyl-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-cyclohexyl-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 15184090 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | N-cyclohexyl-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NC2CCCCC2)nc(OC)n1 |
| InChI | InChI=1S/C11H18N4O2/c1-16-10-13-9(14-11(15-10)17-2)12-8-6-4-3-5-7-8/h8H,3-7H2,1-2H3,(H,12,13,14,15) |
| InChIKey | BQBJLTXZKQRIBT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |