C14H24N4O2 — CID 63541208
N-(1-cyclohexylpropyl)-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 63541208) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(1-cyclohexylpropyl)-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-(1-cyclohexylpropyl)-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63541208 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N-(1-cyclohexylpropyl)-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | CCC(Nc1nc(OC)nc(OC)n1)C1CCCCC1 |
| InChI | InChI=1S/C14H24N4O2/c1-4-11(10-8-6-5-7-9-10)15-12-16-13(19-2)18-14(17-12)20-3/h10-11H,4-9H2,1-3H3,(H,15,16,17,18) |
| InChIKey | AWBBWCYIFXFUPC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |