C11H20N4O2 — CID 62859814
N-hexan-3-yl-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 62859814) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is N-hexan-3-yl-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-hexan-3-yl-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62859814 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N-hexan-3-yl-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | CCCC(CC)Nc1nc(OC)nc(OC)n1 |
| InChI | InChI=1S/C11H20N4O2/c1-5-7-8(6-2)12-9-13-10(16-3)15-11(14-9)17-4/h8H,5-7H2,1-4H3,(H,12,13,14,15) |
| InChIKey | YIDQLRYRQOJOHS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |