C13H25N5 — CID 112746179
6-tert-butyl-2-N-hexan-3-yl-1,3,5-triazine-2,4-diamine (PubChem CID 112746179) has the molecular formula C13H25N5 and a molecular weight of 251.38 g/mol. Its IUPAC name is 6-tert-butyl-2-N-hexan-3-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-tert-butyl-2-N-hexan-3-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112746179 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 6-tert-butyl-2-N-hexan-3-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCC(CC)Nc1nc(N)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C13H25N5/c1-6-8-9(7-2)15-12-17-10(13(3,4)5)16-11(14)18-12/h9H,6-8H2,1-5H3,(H3,14,15,16,17,18) |
| InChIKey | WGNRVLLWVPLWRJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |