C12H23N5 — CID 112746139
6-tert-butyl-2-N-pentan-3-yl-1,3,5-triazine-2,4-diamine (PubChem CID 112746139) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is 6-tert-butyl-2-N-pentan-3-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-tert-butyl-2-N-pentan-3-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112746139 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | 6-tert-butyl-2-N-pentan-3-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCC(CC)Nc1nc(N)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H23N5/c1-6-8(7-2)14-11-16-9(12(3,4)5)15-10(13)17-11/h8H,6-7H2,1-5H3,(H3,13,14,15,16,17) |
| InChIKey | IGRFFCVMPDTPOH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |