C10H16F3N5 — CID 112746495
2-N-hexan-2-yl-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 112746495) has the molecular formula C10H16F3N5 and a molecular weight of 263.27 g/mol. Its IUPAC name is 2-N-hexan-2-yl-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-hexan-2-yl-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112746495 |
| Molecular Formula | C10H16F3N5 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-N-hexan-2-yl-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCC(C)Nc1nc(N)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H16F3N5/c1-3-4-5-6(2)15-9-17-7(10(11,12)13)16-8(14)18-9/h6H,3-5H2,1-2H3,(H3,14,15,16,17,18) |
| InChIKey | GZQAHDIVVGUWIW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |