C9H14F3N3S — CID 107304897
N-hexan-2-yl-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 107304897) has the molecular formula C9H14F3N3S and a molecular weight of 253.29 g/mol. Its IUPAC name is N-hexan-2-yl-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-hexan-2-yl-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 107304897 |
| Molecular Formula | C9H14F3N3S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | N-hexan-2-yl-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCCCC(C)Nc1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C9H14F3N3S/c1-3-4-5-6(2)13-8-14-7(15-16-8)9(10,11)12/h6H,3-5H2,1-2H3,(H,13,14,15) |
| InChIKey | GBXSAGAPJQWDQA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |