C14H27N3S — CID 65276939
3-tert-butyl-N-octan-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 65276939) has the molecular formula C14H27N3S and a molecular weight of 269.46 g/mol. Its IUPAC name is 3-tert-butyl-N-octan-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-tert-butyl-N-octan-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65276939 |
| Molecular Formula | C14H27N3S |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 3-tert-butyl-N-octan-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CCCCCCC(C)Nc1nc(C(C)(C)C)ns1 |
| InChI | InChI=1S/C14H27N3S/c1-6-7-8-9-10-11(2)15-13-16-12(17-18-13)14(3,4)5/h11H,6-10H2,1-5H3,(H,15,16,17) |
| InChIKey | GGDYVABCHMGVGZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|