C11H21N3OS — CID 65271490
3-tert-butyl-N-(3-ethoxypropyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65271490) has the molecular formula C11H21N3OS and a molecular weight of 243.37 g/mol. Its IUPAC name is 3-tert-butyl-N-(3-ethoxypropyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-tert-butyl-N-(3-ethoxypropyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65271490 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-tert-butyl-N-(3-ethoxypropyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCOCCCNC1=NC(=NS1)C(C)(C)C |
| InChI | InChI=1S/C11H21N3OS/c1-5-15-8-6-7-12-10-13-9(14-16-10)11(2,3)4/h5-8H2,1-4H3,(H,12,13,14) |
| InChIKey | YBURLRKGVAIPJZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | 196 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|