C8H13F3N4OS — CID 106308254
N-[3-(2-aminoethoxy)propyl]-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 106308254) has the molecular formula C8H13F3N4OS and a molecular weight of 270.28 g/mol. Its IUPAC name is N-[3-(2-aminoethoxy)propyl]-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[3-(2-aminoethoxy)propyl]-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 106308254 |
| Molecular Formula | C8H13F3N4OS |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-[3-(2-aminoethoxy)propyl]-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | NCCOCCCNc1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C8H13F3N4OS/c9-8(10,11)6-14-7(17-15-6)13-3-1-4-16-5-2-12/h1-5,12H2,(H,13,14,15) |
| InChIKey | KZDISQZHNBLERW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|