C6H7F3N4O2S — CID 107305091
2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]ethyl carbamate (PubChem CID 107305091) has the molecular formula C6H7F3N4O2S and a molecular weight of 256.21 g/mol. Its IUPAC name is 2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]ethyl carbamate.
| Compound Name | 2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 107305091 |
| Molecular Formula | C6H7F3N4O2S |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C6H7F3N4O2S/c7-6(8,9)3-12-5(16-13-3)11-1-2-15-4(10)14/h1-2H2,(H2,10,14)(H,11,12,13) |
| InChIKey | ZRNYROPVGYFFJC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|