C16H30N4S — CID 65270947
N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-N'-cyclohexyl-N'-methylpropane-1,3-diamine (PubChem CID 65270947) has the molecular formula C16H30N4S and a molecular weight of 310.51 g/mol. Its IUPAC name is N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-N'-cyclohexyl-N'-methylpropane-1,3-diamine.
| Compound Name | N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-N'-cyclohexyl-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 65270947 |
| Molecular Formula | C16H30N4S |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-N'-cyclohexyl-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNc1nc(C(C)(C)C)ns1)C1CCCCC1 |
| InChI | InChI=1S/C16H30N4S/c1-16(2,3)14-18-15(21-19-14)17-11-8-12-20(4)13-9-6-5-7-10-13/h13H,5-12H2,1-4H3,(H,17,18,19) |
| InChIKey | UMVNUKPCXWFUPS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|