C13H21Cl2N5 — CID 106192998
N'-cyclohexyl-N-(4,6-dichloro-1,3,5-triazin-2-yl)-N'-methylpropane-1,3-diamine (PubChem CID 106192998) has the molecular formula C13H21Cl2N5 and a molecular weight of 318.25 g/mol. Its IUPAC name is N'-cyclohexyl-N-(4,6-dichloro-1,3,5-triazin-2-yl)-N'-methylpropane-1,3-diamine.
| Compound Name | N'-cyclohexyl-N-(4,6-dichloro-1,3,5-triazin-2-yl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106192998 |
| Molecular Formula | C13H21Cl2N5 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N'-cyclohexyl-N-(4,6-dichloro-1,3,5-triazin-2-yl)-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNc1nc(Cl)nc(Cl)n1)C1CCCCC1 |
| InChI | InChI=1S/C13H21Cl2N5/c1-20(10-6-3-2-4-7-10)9-5-8-16-13-18-11(14)17-12(15)19-13/h10H,2-9H2,1H3,(H,16,17,18,19) |
| InChIKey | DQTSGRRUIDZDOQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|