C15H22Cl3N3 — CID 106193002
N'-cyclohexyl-N'-methyl-N-(3,5,6-trichloro-2-pyridinyl)propane-1,3-diamine (PubChem CID 106193002) has the molecular formula C15H22Cl3N3 and a molecular weight of 350.72 g/mol. Its IUPAC name is N'-cyclohexyl-N'-methyl-N-(3,5,6-trichloro-2-pyridinyl)propane-1,3-diamine.
| Compound Name | N'-cyclohexyl-N'-methyl-N-(3,5,6-trichloro-2-pyridinyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 106193002 |
| Molecular Formula | C15H22Cl3N3 |
| Molecular Weight | 350.72 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N'-cyclohexyl-N'-methyl-N-(3,5,6-trichloro-2-pyridinyl)propane-1,3-diamine |
| SMILES | CN(CCCNc1nc(Cl)c(Cl)cc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C15H22Cl3N3/c1-21(11-6-3-2-4-7-11)9-5-8-19-15-13(17)10-12(16)14(18)20-15/h10-11H,2-9H2,1H3,(H,19,20) |
| InChIKey | PTOKSWXUQJTQSV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.72 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|