C11H15Cl3N2O — CID 102751695
3,5,6-trichloro-N-(3-propoxypropyl)pyridin-2-amine (PubChem CID 102751695) has the molecular formula C11H15Cl3N2O and a molecular weight of 297.61 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(3-propoxypropyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(3-propoxypropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102751695 |
| Molecular Formula | C11H15Cl3N2O |
| Molecular Weight | 297.61 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 3,5,6-trichloro-N-(3-propoxypropyl)pyridin-2-amine |
| SMILES | CCCOCCCNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl3N2O/c1-2-5-17-6-3-4-15-11-9(13)7-8(12)10(14)16-11/h7H,2-6H2,1H3,(H,15,16) |
| InChIKey | DRHUSQJDSWDBJA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|