C11H16Cl2FN3 — CID 114267273
3,5-dichloro-6-N-(3-fluoropropyl)-2-N-propylpyridine-2,6-diamine (PubChem CID 114267273) has the molecular formula C11H16Cl2FN3 and a molecular weight of 280.17 g/mol. Its IUPAC name is 3,5-dichloro-6-N-(3-fluoropropyl)-2-N-propylpyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-(3-fluoropropyl)-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 114267273 |
| Molecular Formula | C11H16Cl2FN3 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3,5-dichloro-6-N-(3-fluoropropyl)-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCNc1nc(NCCCF)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H16Cl2FN3/c1-2-5-15-10-8(12)7-9(13)11(17-10)16-6-3-4-14/h7H,2-6H2,1H3,(H2,15,16,17) |
| InChIKey | SQXHXRYSIAVKOO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|