C14H23Cl2N3O — CID 106163265
5-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]amino]-2-methylpentan-1-ol (PubChem CID 106163265) has the molecular formula C14H23Cl2N3O and a molecular weight of 320.26 g/mol. Its IUPAC name is 5-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]amino]-2-methylpentan-1-ol.
| Compound Name | 5-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]amino]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 106163265 |
| Molecular Formula | C14H23Cl2N3O |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 5-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]amino]-2-methylpentan-1-ol |
| SMILES | CCCNc1nc(NCCCC(C)CO)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H23Cl2N3O/c1-3-6-17-13-11(15)8-12(16)14(19-13)18-7-4-5-10(2)9-20/h8,10,20H,3-7,9H2,1-2H3,(H2,17,18,19) |
| InChIKey | MOXPXOFPZFRNNB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|