C14H22Cl2N2O — CID 103286396
3,5-dichloro-6-(2-methylpentoxy)-N-propylpyridin-2-amine (PubChem CID 103286396) has the molecular formula C14H22Cl2N2O and a molecular weight of 305.25 g/mol. Its IUPAC name is 3,5-dichloro-6-(2-methylpentoxy)-N-propylpyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(2-methylpentoxy)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 103286396 |
| Molecular Formula | C14H22Cl2N2O |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3,5-dichloro-6-(2-methylpentoxy)-N-propylpyridin-2-amine |
| SMILES | CCCNc1nc(OCC(C)CCC)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H22Cl2N2O/c1-4-6-10(3)9-19-14-12(16)8-11(15)13(18-14)17-7-5-2/h8,10H,4-7,9H2,1-3H3,(H,17,18) |
| InChIKey | ZDUFSASTLNAGBU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |