C14H16Cl2N2OS — CID 102760896
3,5-dichloro-N-propyl-6-(2-thiophen-2-ylethoxy)pyridin-2-amine (PubChem CID 102760896) has the molecular formula C14H16Cl2N2OS and a molecular weight of 331.27 g/mol. Its IUPAC name is 3,5-dichloro-N-propyl-6-(2-thiophen-2-ylethoxy)pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-propyl-6-(2-thiophen-2-ylethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 102760896 |
| Molecular Formula | C14H16Cl2N2OS |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 3,5-dichloro-N-propyl-6-(2-thiophen-2-ylethoxy)pyridin-2-amine |
| SMILES | CCCNc1nc(OCCc2cccs2)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2N2OS/c1-2-6-17-13-11(15)9-12(16)14(18-13)19-7-5-10-4-3-8-20-10/h3-4,8-9H,2,5-7H2,1H3,(H,17,18) |
| InChIKey | YYXIRRUPPNNCKQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |