C13H18Cl2N2O — CID 106207557
3,5-dichloro-6-(2-cyclopropylethoxy)-N-propylpyridin-2-amine (PubChem CID 106207557) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is 3,5-dichloro-6-(2-cyclopropylethoxy)-N-propylpyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(2-cyclopropylethoxy)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 106207557 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3,5-dichloro-6-(2-cyclopropylethoxy)-N-propylpyridin-2-amine |
| SMILES | CCCNc1nc(OCCC2CC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2N2O/c1-2-6-16-12-10(14)8-11(15)13(17-12)18-7-5-9-3-4-9/h8-9H,2-7H2,1H3,(H,16,17) |
| InChIKey | YNKFAVOIUPQNLN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |