C13H20Cl2N2O2 — CID 102760364
6-(2-butoxyethoxy)-3,5-dichloro-N-ethylpyridin-2-amine (PubChem CID 102760364) has the molecular formula C13H20Cl2N2O2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 6-(2-butoxyethoxy)-3,5-dichloro-N-ethylpyridin-2-amine.
| Compound Name | 6-(2-butoxyethoxy)-3,5-dichloro-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 102760364 |
| Molecular Formula | C13H20Cl2N2O2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 6-(2-butoxyethoxy)-3,5-dichloro-N-ethylpyridin-2-amine |
| SMILES | CCCCOCCOc1nc(NCC)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H20Cl2N2O2/c1-3-5-6-18-7-8-19-13-11(15)9-10(14)12(17-13)16-4-2/h9H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | SJHQDONOGUVEOZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|