C11H13Cl2F3N2O — CID 102761118
3,5-dichloro-N-ethyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine (PubChem CID 102761118) has the molecular formula C11H13Cl2F3N2O and a molecular weight of 317.14 g/mol. Its IUPAC name is 3,5-dichloro-N-ethyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-ethyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 102761118 |
| Molecular Formula | C11H13Cl2F3N2O |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 3,5-dichloro-N-ethyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine |
| SMILES | CCNc1nc(OCCCC(F)(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2F3N2O/c1-2-17-9-7(12)6-8(13)10(18-9)19-5-3-4-11(14,15)16/h6H,2-5H2,1H3,(H,17,18) |
| InChIKey | DGCBICDUVMZIND-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|