C10H11ClF3NO — CID 155156958
3-chloro-5-methyl-2-(4,4,4-trifluorobutoxy)pyridine (PubChem CID 155156958) has the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. Its IUPAC name is 3-chloro-5-methyl-2-(4,4,4-trifluorobutoxy)pyridine.
| Compound Name | 3-chloro-5-methyl-2-(4,4,4-trifluorobutoxy)pyridine |
|---|---|
| PubChem CID | 155156958 |
| Molecular Formula | C10H11ClF3NO |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3-chloro-5-methyl-2-(4,4,4-trifluorobutoxy)pyridine |
| SMILES | Cc1cnc(OCCCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H11ClF3NO/c1-7-5-8(11)9(15-6-7)16-4-2-3-10(12,13)14/h5-6H,2-4H2,1H3 |
| InChIKey | HWFSYROQFAUCIL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|