C12H9Cl3N2O — CID 58615529
2,3-dichloro-5-[(3-chloro-5-methyl-2-pyridinyl)oxymethyl]pyridine (PubChem CID 58615529) has the molecular formula C12H9Cl3N2O and a molecular weight of 303.58 g/mol. Its IUPAC name is 2,3-dichloro-5-[(3-chloro-5-methyl-2-pyridinyl)oxymethyl]pyridine.
| Compound Name | 2,3-dichloro-5-[(3-chloro-5-methyl-2-pyridinyl)oxymethyl]pyridine |
|---|---|
| PubChem CID | 58615529 |
| Molecular Formula | C12H9Cl3N2O |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 2,3-dichloro-5-[(3-chloro-5-methyl-2-pyridinyl)oxymethyl]pyridine |
| SMILES | Cc1cnc(OCc2cnc(Cl)c(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C12H9Cl3N2O/c1-7-2-10(14)12(17-4-7)18-6-8-3-9(13)11(15)16-5-8/h2-5H,6H2,1H3 |
| InChIKey | MJTAJBGOSGCXFR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|