C12H19Cl2NO2Si — CID 58625816
2-[(5,6-dichloro-3-pyridinyl)methoxymethoxy]ethyl-trimethylsilane (PubChem CID 58625816) has the molecular formula C12H19Cl2NO2Si and a molecular weight of 308.28 g/mol. Its IUPAC name is 2-[(5,6-dichloro-3-pyridinyl)methoxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(5,6-dichloro-3-pyridinyl)methoxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58625816 |
| Molecular Formula | C12H19Cl2NO2Si |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-[(5,6-dichloro-3-pyridinyl)methoxymethoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCOCc1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H19Cl2NO2Si/c1-18(2,3)5-4-16-9-17-8-10-6-11(13)12(14)15-7-10/h6-7H,4-5,8-9H2,1-3H3 |
| InChIKey | MMVQMDWXONCACE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|