C14H21ClN2O2Si — CID 140769621
[2-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]methanol (PubChem CID 140769621) has the molecular formula C14H21ClN2O2Si and a molecular weight of 312.87 g/mol. Its IUPAC name is [2-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]methanol.
| Compound Name | [2-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]methanol |
|---|---|
| PubChem CID | 140769621 |
| Molecular Formula | C14H21ClN2O2Si |
| Molecular Weight | 312.87 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [2-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]methanol |
| SMILES | C[Si](C)(C)CCOCn1c(Cl)cc2cc(CO)cnc21 |
| InChI | InChI=1S/C14H21ClN2O2Si/c1-20(2,3)5-4-19-10-17-13(15)7-12-6-11(9-18)8-16-14(12)17/h6-8,18H,4-5,9-10H2,1-3H3 |
| InChIKey | SNIUDTKGVPKXGL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.87 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|