C18H24ClN5O2Si — CID 153351965
6-chloro-2-(pyridin-4-ylmethoxy)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 153351965) has the molecular formula C18H24ClN5O2Si and a molecular weight of 405.96 g/mol. Its IUPAC name is 6-chloro-2-(pyridin-4-ylmethoxy)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-(pyridin-4-ylmethoxy)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 153351965 |
| Molecular Formula | C18H24ClN5O2Si |
| Molecular Weight | 405.96 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 6-chloro-2-(pyridin-4-ylmethoxy)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[Si](C)(C)CCOCn1c(Cl)cc2c(N)nc(OCc3ccncc3)nc21 |
| InChI | InChI=1S/C18H24ClN5O2Si/c1-27(2,3)9-8-25-12-24-15(19)10-14-16(20)22-18(23-17(14)24)26-11-13-4-6-21-7-5-13/h4-7,10H,8-9,11-12H2,1-3H3,(H2,20,22,23) |
| InChIKey | QGWRWKSHXAMDSH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.96 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|