C14H18ClF3N2OSi — CID 162760836
2-[[4-chloro-2-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 162760836) has the molecular formula C14H18ClF3N2OSi and a molecular weight of 350.84 g/mol. Its IUPAC name is 2-[[4-chloro-2-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-chloro-2-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 162760836 |
| Molecular Formula | C14H18ClF3N2OSi |
| Molecular Weight | 350.84 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2-[[4-chloro-2-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(C(F)(F)F)cc2c(Cl)ccnc21 |
| InChI | InChI=1S/C14H18ClF3N2OSi/c1-22(2,3)7-6-21-9-20-12(14(16,17)18)8-10-11(15)4-5-19-13(10)20/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | NRROBXHAIRQCAH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|