C17H19ClN4OSi — CID 58266668
13-chloro-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile (PubChem CID 58266668) has the molecular formula C17H19ClN4OSi and a molecular weight of 358.91 g/mol. Its IUPAC name is 13-chloro-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile.
| Compound Name | 13-chloro-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266668 |
| Molecular Formula | C17H19ClN4OSi |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 13-chloro-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1c2cnc(C#N)cc2c2c(Cl)ccnc21 |
| InChI | InChI=1S/C17H19ClN4OSi/c1-24(2,3)7-6-23-11-22-15-10-21-12(9-19)8-13(15)16-14(18)4-5-20-17(16)22/h4-5,8,10H,6-7,11H2,1-3H3 |
| InChIKey | ZVIBMXQOAXHXSH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|