C21H27N5O2Si — CID 58365043
13-[(3S)-3-hydroxypyrrolidin-1-yl]-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile (PubChem CID 58365043) has the molecular formula C21H27N5O2Si and a molecular weight of 409.57 g/mol. Its IUPAC name is 13-[(3S)-3-hydroxypyrrolidin-1-yl]-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile.
| Compound Name | 13-[(3S)-3-hydroxypyrrolidin-1-yl]-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58365043 |
| Molecular Formula | C21H27N5O2Si |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 13-[(3S)-3-hydroxypyrrolidin-1-yl]-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1c2cnc(C#N)cc2c2c(N3CC[C@H](O)C3)ccnc21 |
| InChI | InChI=1S/C21H27N5O2Si/c1-29(2,3)9-8-28-14-26-19-12-24-15(11-22)10-17(19)20-18(4-6-23-21(20)26)25-7-5-16(27)13-25/h4,6,10,12,16,27H,5,7-9,13-14H2,1-3H3/t16-/m0/s1 |
| InChIKey | PRDHWWYWEKCQBJ-INIZCTEOSA-N |
| XLogP | 3.34 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|