C32H45N7O4Si — CID 58365023
tert-butyl (2S)-2-[2-[4-[4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-1-carboxylate (PubChem CID 58365023) has the molecular formula C32H45N7O4Si and a molecular weight of 619.84 g/mol. Its IUPAC name is tert-butyl (2S)-2-[2-[4-[4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[2-[4-[4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58365023 |
| Molecular Formula | C32H45N7O4Si |
| Molecular Weight | 619.84 g/mol |
| Exact Mass | 619.33 |
| IUPAC Name | tert-butyl (2S)-2-[2-[4-[4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CC(=O)N1CCN(c2ccnc3c2c2cc(C#N)ncc2n3COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C32H45N7O4Si/c1-32(2,3)43-31(41)38-11-7-8-24(38)19-28(40)37-14-12-36(13-15-37)26-9-10-34-30-29(26)25-18-23(20-33)35-21-27(25)39(30)22-42-16-17-44(4,5)6/h9-10,18,21,24H,7-8,11-17,19,22H2,1-6H3/t24-/m0/s1 |
| InChIKey | BUERQMTXIXCMLQ-DEOSSOPVSA-N |
| XLogP | 5.21 |
| TPSA | 116.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.84 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|