C24H32N6O3Si — CID 67248963
[4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl] N-ethyl-N-pyrrolidin-3-ylcarbamate (PubChem CID 67248963) has the molecular formula C24H32N6O3Si and a molecular weight of 480.65 g/mol. Its IUPAC name is [4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl] N-ethyl-N-pyrrolidin-3-ylcarbamate.
| Compound Name | [4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl] N-ethyl-N-pyrrolidin-3-ylcarbamate |
|---|---|
| PubChem CID | 67248963 |
| Molecular Formula | C24H32N6O3Si |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | [4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl] N-ethyl-N-pyrrolidin-3-ylcarbamate |
| SMILES | CCN(C(=O)Oc1ccnc2c1c1cc(C#N)ncc1n2COCC[Si](C)(C)C)C1CCNC1 |
| InChI | InChI=1S/C24H32N6O3Si/c1-5-29(18-6-8-26-14-18)24(31)33-21-7-9-27-23-22(21)19-12-17(13-25)28-15-20(19)30(23)16-32-10-11-34(2,3)4/h7,9,12,15,18,26H,5-6,8,10-11,14,16H2,1-4H3 |
| InChIKey | RKXYFMXLPOTZIQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|