C29H41FN6O3Si — CID 58364941
tert-butyl N-[(3S)-1-[4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]pyrrolidin-3-yl]-N-(3-fluoropropyl)carbamate (PubChem CID 58364941) has the molecular formula C29H41FN6O3Si and a molecular weight of 568.77 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]pyrrolidin-3-yl]-N-(3-fluoropropyl)carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]pyrrolidin-3-yl]-N-(3-fluoropropyl)carbamate |
|---|---|
| PubChem CID | 58364941 |
| Molecular Formula | C29H41FN6O3Si |
| Molecular Weight | 568.77 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | tert-butyl N-[(3S)-1-[4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]pyrrolidin-3-yl]-N-(3-fluoropropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCF)[C@H]1CCN(c2ccnc3c2c2cc(C#N)ncc2n3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C29H41FN6O3Si/c1-29(2,3)39-28(37)35(12-7-10-30)22-9-13-34(19-22)24-8-11-32-27-26(24)23-16-21(17-31)33-18-25(23)36(27)20-38-14-15-40(4,5)6/h8,11,16,18,22H,7,9-10,12-15,19-20H2,1-6H3/t22-/m0/s1 |
| InChIKey | HJIZHMXQSYEJOO-QFIPXVFZSA-N |
| XLogP | 5.94 |
| TPSA | 96.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.77 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|