C29H43N5O3Si — CID 165156475
tert-butyl N-methyl-N-[(3S)-1-[3-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]carbamate (PubChem CID 165156475) has the molecular formula C29H43N5O3Si and a molecular weight of 537.78 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[(3S)-1-[3-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[(3S)-1-[3-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 165156475 |
| Molecular Formula | C29H43N5O3Si |
| Molecular Weight | 537.78 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | tert-butyl N-methyl-N-[(3S)-1-[3-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@H]1CCCN(c2ccnc3c2c(-c2ccccn2)cn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C29H43N5O3Si/c1-29(2,3)37-28(35)32(4)22-11-10-16-33(19-22)25-13-15-31-27-26(25)23(24-12-8-9-14-30-24)20-34(27)21-36-17-18-38(5,6)7/h8-9,12-15,20,22H,10-11,16-19,21H2,1-7H3/t22-/m0/s1 |
| InChIKey | BTJOJUYFQRMUME-QFIPXVFZSA-N |
| XLogP | 6.25 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.78 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|