C17H26N2O4 — CID 97167011
tert-butyl N-[(3R)-1-[2-(furan-2-yl)-2-oxoethyl]piperidin-3-yl]-N-methylcarbamate (PubChem CID 97167011) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[2-(furan-2-yl)-2-oxoethyl]piperidin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(3R)-1-[2-(furan-2-yl)-2-oxoethyl]piperidin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 97167011 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | tert-butyl N-[(3R)-1-[2-(furan-2-yl)-2-oxoethyl]piperidin-3-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H]1CCCN(CC(=O)c2ccco2)C1 |
| InChI | InChI=1S/C17H26N2O4/c1-17(2,3)23-16(21)18(4)13-7-5-9-19(11-13)12-14(20)15-8-6-10-22-15/h6,8,10,13H,5,7,9,11-12H2,1-4H3/t13-/m1/s1 |
| InChIKey | HLQHLNRLMSLHEH-CYBMUJFWSA-N |
| XLogP | 2.79 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |