C26H39BN6O2Si — CID 165156609
N-cyclopropyl-methyl-N-[(3S)-1-[3-pyridazin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]boronamidic acid (PubChem CID 165156609) has the molecular formula C26H39BN6O2Si and a molecular weight of 506.54 g/mol. Its IUPAC name is N-cyclopropyl-methyl-N-[(3S)-1-[3-pyridazin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]boronamidic acid.
| Compound Name | N-cyclopropyl-methyl-N-[(3S)-1-[3-pyridazin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]boronamidic acid |
|---|---|
| PubChem CID | 165156609 |
| Molecular Formula | C26H39BN6O2Si |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | N-cyclopropyl-methyl-N-[(3S)-1-[3-pyridazin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]boronamidic acid |
| SMILES | CB(O)N(C1CC1)[C@H]1CCCN(c2ccnc3c2c(-c2cccnn2)cn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C26H39BN6O2Si/c1-27(34)33(20-9-10-20)21-7-6-14-31(17-21)24-11-13-28-26-25(24)22(23-8-5-12-29-30-23)18-32(26)19-35-15-16-36(2,3)4/h5,8,11-13,18,20-21,34H,6-7,9-10,14-17,19H2,1-4H3/t21-/m0/s1 |
| InChIKey | CBWILOMKIJNPBL-NRFANRHFSA-N |
| XLogP | 4.35 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|